C11H19F2N3OS — CID 103213304
3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine (PubChem CID 103213304) has the molecular formula C11H19F2N3OS and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine.
| Compound Name | 3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 103213304 |
| Molecular Formula | C11H19F2N3OS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1nnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C11H19F2N3OS/c1-2-14-6-3-4-10-15-16-11(18-10)5-7-17-8-9(12)13/h9,14H,2-8H2,1H3 |
| InChIKey | ZKBQJGRKOLTULF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|