C12H20F3N3OS — CID 103213322
2-methyl-N-[3-[5-(2,2,2-trifluoroethoxymethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine (PubChem CID 103213322) has the molecular formula C12H20F3N3OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-methyl-N-[3-[5-(2,2,2-trifluoroethoxymethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine.
| Compound Name | 2-methyl-N-[3-[5-(2,2,2-trifluoroethoxymethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine |
|---|---|
| PubChem CID | 103213322 |
| Molecular Formula | C12H20F3N3OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-methyl-N-[3-[5-(2,2,2-trifluoroethoxymethyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine |
| SMILES | CC(C)CNCCCc1nnc(COCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H20F3N3OS/c1-9(2)6-16-5-3-4-10-17-18-11(20-10)7-19-8-12(13,14)15/h9,16H,3-8H2,1-2H3 |
| InChIKey | CLHQRVAFDADDEH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|