C13H23F2N3OS — CID 103213324
N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 103213324) has the molecular formula C13H23F2N3OS and a molecular weight of 307.41 g/mol. Its IUPAC name is N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 103213324 |
| Molecular Formula | C13H23F2N3OS |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1nnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C13H23F2N3OS/c1-10(2)8-16-6-3-4-12-17-18-13(20-12)5-7-19-9-11(14)15/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | WFARCQWBSCFNHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|