C20H29F2N2O5P — CID 10321336
6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]hexylphosphonic acid (PubChem CID 10321336) has the molecular formula C20H29F2N2O5P and a molecular weight of 446.43 g/mol. Its IUPAC name is 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 10321336 |
| Molecular Formula | C20H29F2N2O5P |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
| SMILES | CN1C[C@H](/C=C/C(O)C(F)(F)c2ccccc2)N(CCCCCCP(=O)(O)O)C1=O |
| InChI | InChI=1S/C20H29F2N2O5P/c1-23-15-17(11-12-18(25)20(21,22)16-9-5-4-6-10-16)24(19(23)26)13-7-2-3-8-14-30(27,28)29/h4-6,9-12,17-18,25H,2-3,7-8,13-15H2,1H3,(H2,27,28,29)/b12-11+/t17-,18?/m0/s1 |
| InChIKey | ZDIUEEAXHMFDJG-ZOVTXPBASA-N |
| XLogP | 3.17 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|