About 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid
3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid (PubChem CID 103213511) has the molecular formula C11H18F2N4O3
and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid.
Molecular Properties
| Compound Name | 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid |
| PubChem CID | 103213511 |
| Molecular Formula | C11H18F2N4O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)Cn1nnnc1CCOCC(F)F |
| InChI | InChI=1S/C11H18F2N4O3/c1-2-8(5-11(18)19)6-17-10(14-15-16-17)3-4-20-7-9(12)13/h8-9H,2-7H2,1H3,(H,18,19) |
| InChIKey | FUKDNDMGIYIXAN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid?
The IUPAC name of 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid (CID 103213511) is 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid.
What is the SMILES notation for 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid?
The canonical SMILES for 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid is CCC(CC(=O)O)Cn1nnnc1CCOCC(F)F.
What is the InChIKey of 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid?
The InChIKey is FUKDNDMGIYIXAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N4O3/c1-2-8(5-11(18)19)6-17-10(14-15-16-17)3-4-20-7-9(12)13/h8-9H,2-7H2,1H3,(H,18,19).
What are the key properties of 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid?
3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid has a molecular weight of 292.29 g/mol, XLogP of 1.00, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]pentanoic acid is sourced from PubChem (CID 103213511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).