C10H14F2N4O3 — CID 103213515
1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid (PubChem CID 103213515) has the molecular formula C10H14F2N4O3 and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103213515 |
| Molecular Formula | C10H14F2N4O3 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(n2nnnc2CCOCC(F)F)CCC1 |
| InChI | InChI=1S/C10H14F2N4O3/c11-7(12)6-19-5-2-8-13-14-15-16(8)10(9(17)18)3-1-4-10/h7H,1-6H2,(H,17,18) |
| InChIKey | TVMJOAQYXBZVAI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|