About 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid
1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid (PubChem CID 103213515) has the molecular formula C10H14F2N4O3
and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid |
| PubChem CID | 103213515 |
| Molecular Formula | C10H14F2N4O3 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(n2nnnc2CCOCC(F)F)CCC1 |
| InChI | InChI=1S/C10H14F2N4O3/c11-7(12)6-19-5-2-8-13-14-15-16(8)10(9(17)18)3-1-4-10/h7H,1-6H2,(H,17,18) |
| InChIKey | TVMJOAQYXBZVAI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid (CID 103213515) is 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid is O=C(O)C1(n2nnnc2CCOCC(F)F)CCC1.
What is the InChIKey of 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid?
The InChIKey is TVMJOAQYXBZVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N4O3/c11-7(12)6-19-5-2-8-13-14-15-16(8)10(9(17)18)3-1-4-10/h7H,1-6H2,(H,17,18).
What are the key properties of 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid?
1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid has a molecular weight of 276.24 g/mol, XLogP of 0.46, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 103213515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).