C10H17F2N3O3 — CID 103213629
[5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 103213629) has the molecular formula C10H17F2N3O3 and a molecular weight of 265.26 g/mol. Its IUPAC name is [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213629 |
| Molecular Formula | C10H17F2N3O3 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | COCCn1c(CO)nnc1CCOCC(F)F |
| InChI | InChI=1S/C10H17F2N3O3/c1-17-5-3-15-9(13-14-10(15)6-16)2-4-18-7-8(11)12/h8,16H,2-7H2,1H3 |
| InChIKey | UJSHZXYZVZFHOX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|