C10H16F3N3O3 — CID 103213630
[4-(2-methoxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol (PubChem CID 103213630) has the molecular formula C10H16F3N3O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is [4-(2-methoxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-(2-methoxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213630 |
| Molecular Formula | C10H16F3N3O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [4-(2-methoxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
| SMILES | COCCn1c(CO)nnc1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O3/c1-18-5-3-16-8(14-15-9(16)6-17)2-4-19-7-10(11,12)13/h17H,2-7H2,1H3 |
| InChIKey | AUSXGWLUEHCSJU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|