C9H15F2N3O2 — CID 103213637
[5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]methanol (PubChem CID 103213637) has the molecular formula C9H15F2N3O2 and a molecular weight of 235.23 g/mol. Its IUPAC name is [5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213637 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]methanol |
| SMILES | CCn1c(CO)nnc1CCOCC(F)F |
| InChI | InChI=1S/C9H15F2N3O2/c1-2-14-8(12-13-9(14)5-15)3-4-16-6-7(10)11/h7,15H,2-6H2,1H3 |
| InChIKey | OFVWEPGTRGNAFX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|