C9H14F3N3O2 — CID 103213638
[4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol (PubChem CID 103213638) has the molecular formula C9H14F3N3O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213638 |
| Molecular Formula | C9H14F3N3O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
| SMILES | CCn1c(CO)nnc1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O2/c1-2-15-7(13-14-8(15)5-16)3-4-17-6-9(10,11)12/h16H,2-6H2,1H3 |
| InChIKey | KYOUVXPVEGLVFV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|