C8H13F2N3O2 — CID 103213642
[5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]methanol (PubChem CID 103213642) has the molecular formula C8H13F2N3O2 and a molecular weight of 221.21 g/mol. Its IUPAC name is [5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213642 |
| Molecular Formula | C8H13F2N3O2 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]methanol |
| SMILES | Cn1c(CO)nnc1CCOCC(F)F |
| InChI | InChI=1S/C8H13F2N3O2/c1-13-7(11-12-8(13)4-14)2-3-15-5-6(9)10/h6,14H,2-5H2,1H3 |
| InChIKey | ALPQOMKHXUJLTF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|