C11H19F2N3O2 — CID 103213645
[5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 103213645) has the molecular formula C11H19F2N3O2 and a molecular weight of 263.29 g/mol. Its IUPAC name is [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213645 |
| Molecular Formula | C11H19F2N3O2 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | CC(C)Cn1c(CO)nnc1CCOCC(F)F |
| InChI | InChI=1S/C11H19F2N3O2/c1-8(2)5-16-10(14-15-11(16)6-17)3-4-18-7-9(12)13/h8-9,17H,3-7H2,1-2H3 |
| InChIKey | JMNGYXRLMKSKDJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|