C9H15F2N3O2 — CID 103213652
3-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 103213652) has the molecular formula C9H15F2N3O2 and a molecular weight of 235.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 103213652 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1CCOCC(F)F |
| InChI | InChI=1S/C9H15F2N3O2/c1-15-5-3-14-7-12-13-9(14)2-4-16-6-8(10)11/h7-8H,2-6H2,1H3 |
| InChIKey | MHUGZDACPFYBIV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|