C12H16F2N2O3 — CID 103213739
2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxylic acid (PubChem CID 103213739) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103213739 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCCc2[nH]c(CCOCC(F)F)nc21 |
| InChI | InChI=1S/C12H16F2N2O3/c13-9(14)6-19-5-4-10-15-8-3-1-2-7(12(17)18)11(8)16-10/h7,9H,1-6H2,(H,15,16)(H,17,18) |
| InChIKey | LJNBVRSIRBJIOL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|