C6H8ClF2N3O3S — CID 103213783
5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213783) has the molecular formula C6H8ClF2N3O3S and a molecular weight of 275.66 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213783 |
| Molecular Formula | C6H8ClF2N3O3S |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1n[nH]c(CCOCC(F)F)n1 |
| InChI | InChI=1S/C6H8ClF2N3O3S/c7-16(13,14)6-10-5(11-12-6)1-2-15-3-4(8)9/h4H,1-3H2,(H,10,11,12) |
| InChIKey | KVYZZWFIOISJKZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|