C5H7F3N4O3S — CID 103213836
5-(2,2,2-trifluoroethoxymethyl)-1H-1,2,4-triazole-3-sulfonamide (PubChem CID 103213836) has the molecular formula C5H7F3N4O3S and a molecular weight of 260.20 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxymethyl)-1H-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-(2,2,2-trifluoroethoxymethyl)-1H-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213836 |
| Molecular Formula | C5H7F3N4O3S |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxymethyl)-1H-1,2,4-triazole-3-sulfonamide |
| SMILES | NS(=O)(=O)c1n[nH]c(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C5H7F3N4O3S/c6-5(7,8)2-15-1-3-10-4(12-11-3)16(9,13)14/h1-2H2,(H2,9,13,14)(H,10,11,12) |
| InChIKey | PEPAVMJXCODUDS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |