About 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole
2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole (PubChem CID 103213875) has the molecular formula C6H7ClF2N2O2
and a molecular weight of 212.58 g/mol. Its IUPAC name is 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole |
| PubChem CID | 103213875 |
| Molecular Formula | C6H7ClF2N2O2 |
| Molecular Weight | 212.58 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole |
| SMILES | FC(F)COCCc1nnc(Cl)o1 |
| InChI | InChI=1S/C6H7ClF2N2O2/c7-6-11-10-5(13-6)1-2-12-3-4(8)9/h4H,1-3H2 |
| InChIKey | HRUSZHFEDUGWLV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole?
The IUPAC name of 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole (CID 103213875) is 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole?
The canonical SMILES for 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole is FC(F)COCCc1nnc(Cl)o1.
What is the InChIKey of 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole?
The InChIKey is HRUSZHFEDUGWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClF2N2O2/c7-6-11-10-5(13-6)1-2-12-3-4(8)9/h4H,1-3H2.
What are the key properties of 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole?
2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole has a molecular weight of 212.58 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole is sourced from PubChem (CID 103213875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).