About 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one
1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one (PubChem CID 103214036) has the molecular formula C10H15F3O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one |
| PubChem CID | 103214036 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)F)CC1CCCC1 |
| InChI | InChI=1S/C10H15F3O2/c11-10(12,13)7-15-6-9(14)5-8-3-1-2-4-8/h8H,1-7H2 |
| InChIKey | MMNXSGDHPXURAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one?
The IUPAC name of 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one (CID 103214036) is 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one.
What is the SMILES notation for 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one?
The canonical SMILES for 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one is O=C(COCC(F)(F)F)CC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one?
The InChIKey is MMNXSGDHPXURAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O2/c11-10(12,13)7-15-6-9(14)5-8-3-1-2-4-8/h8H,1-7H2.
What are the key properties of 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one?
1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one has a molecular weight of 224.22 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(2,2,2-trifluoroethoxy)propan-2-one is sourced from PubChem (CID 103214036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).