About 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one
5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one (PubChem CID 103214167) has the molecular formula C11H17F3O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one.
Molecular Properties
| Compound Name | 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one |
| PubChem CID | 103214167 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one |
| SMILES | O=C(CCCC1CCCO1)COCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O3/c12-11(13,14)8-16-7-9(15)3-1-4-10-5-2-6-17-10/h10H,1-8H2 |
| InChIKey | UMBLBQMBHGTZSI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one?
The IUPAC name of 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one (CID 103214167) is 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one.
What is the SMILES notation for 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one?
The canonical SMILES for 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one is O=C(CCCC1CCCO1)COCC(F)(F)F.
What is the InChIKey of 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one?
The InChIKey is UMBLBQMBHGTZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O3/c12-11(13,14)8-16-7-9(15)3-1-4-10-5-2-6-17-10/h10H,1-8H2.
What are the key properties of 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one?
5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one has a molecular weight of 254.25 g/mol, XLogP of 2.48, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-2-yl)-1-(2,2,2-trifluoroethoxy)pentan-2-one is sourced from PubChem (CID 103214167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).