C16H16BrClINO — CID 103214776
2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine (PubChem CID 103214776) has the molecular formula C16H16BrClINO and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 103214776 |
| Molecular Formula | C16H16BrClINO |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(OC)c(Br)c1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C16H16BrClINO/c1-20-15(11-4-5-14(19)13(18)9-11)8-10-3-6-16(21-2)12(17)7-10/h3-7,9,15,20H,8H2,1-2H3 |
| InChIKey | KOEXTUVDZUMFRA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|