C12H13F6NO — CID 103215253
N-ethyl-2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 103215253) has the molecular formula C12H13F6NO and a molecular weight of 301.23 g/mol. Its IUPAC name is N-ethyl-2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | N-ethyl-2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 103215253 |
| Molecular Formula | C12H13F6NO |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-ethyl-2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CCNC(COCC(F)(F)F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H13F6NO/c1-2-19-9(5-20-6-12(16,17)18)7-3-4-8(13)11(15)10(7)14/h3-4,9,19H,2,5-6H2,1H3 |
| InChIKey | FZRUTNNULVOPRJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|