C10H14F3N3O — CID 103215347
N-ethyl-1-pyrazin-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 103215347) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is N-ethyl-1-pyrazin-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-ethyl-1-pyrazin-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103215347 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-ethyl-1-pyrazin-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)F)c1cnccn1 |
| InChI | InChI=1S/C10H14F3N3O/c1-2-15-9(6-17-7-10(11,12)13)8-5-14-3-4-16-8/h3-5,9,15H,2,6-7H2,1H3 |
| InChIKey | KNBSNIMSVJHPOD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |