About 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione
5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 10321562) has the molecular formula C19H12Cl2N2O3S2
and a molecular weight of 451.36 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 10321562 |
| Molecular Formula | C19H12Cl2N2O3S2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | O=S(=O)(c1ccccc1)c1cc2[nH]c(=S)[nH]c2cc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H12Cl2N2O3S2/c20-12-7-4-8-15(18(12)21)26-16-9-13-14(23-19(27)22-13)10-17(16)28(24,25)11-5-2-1-3-6-11/h1-10H,(H2,22,23,27) |
| InChIKey | WBJAWGRTJBQWOW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione (CID 10321562) is 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione is O=S(=O)(c1ccccc1)c1cc2[nH]c(=S)[nH]c2cc1Oc1cccc(Cl)c1Cl.
What is the InChIKey of 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is WBJAWGRTJBQWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2N2O3S2/c20-12-7-4-8-15(18(12)21)26-16-9-13-14(23-19(27)22-13)10-17(16)28(24,25)11-5-2-1-3-6-11/h1-10H,(H2,22,23,27).
What are the key properties of 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 451.36 g/mol, XLogP of 6.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-6-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 10321562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).