C30H29NO3 — CID 10321580
N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide (PubChem CID 10321580) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 10321580 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(CC(NC(=O)C(c2ccccc2)c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H29NO3/c1-33-27-19-18-22(21-28(27)34-2)20-26(23-12-6-3-7-13-23)31-30(32)29(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19,21,26,29H,20H2,1-2H3,(H,31,32) |
| InChIKey | RMGYOKIILRFJTF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |