About 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine
5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine (PubChem CID 103216587) has the molecular formula C10H20F3NO2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine.
Molecular Properties
| Compound Name | 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine |
| PubChem CID | 103216587 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine |
| SMILES | COC(C)(C)CCC(N)COCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-9(2,15-3)5-4-8(14)6-16-7-10(11,12)13/h8H,4-7,14H2,1-3H3 |
| InChIKey | JQAVSFUMASKNDY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine?
The IUPAC name of 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine (CID 103216587) is 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine.
What is the SMILES notation for 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine?
The canonical SMILES for 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine is COC(C)(C)CCC(N)COCC(F)(F)F.
What is the InChIKey of 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine?
The InChIKey is JQAVSFUMASKNDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO2/c1-9(2,15-3)5-4-8(14)6-16-7-10(11,12)13/h8H,4-7,14H2,1-3H3.
What are the key properties of 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine?
5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine has a molecular weight of 243.27 g/mol, XLogP of 2.10, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-5-methyl-1-(2,2,2-trifluoroethoxy)hexan-2-amine is sourced from PubChem (CID 103216587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).