About 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol
5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol (PubChem CID 103216845) has the molecular formula C9H17F3O4S
and a molecular weight of 278.29 g/mol. Its IUPAC name is 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol |
| PubChem CID | 103216845 |
| Molecular Formula | C9H17F3O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(O)COCC(F)(F)F |
| InChI | InChI=1S/C9H17F3O4S/c1-2-17(14,15)5-3-4-8(13)6-16-7-9(10,11)12/h8,13H,2-7H2,1H3 |
| InChIKey | UZLKKCSVDOUVQM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol?
The IUPAC name of 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol (CID 103216845) is 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol.
What is the SMILES notation for 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol?
The canonical SMILES for 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol is CCS(=O)(=O)CCCC(O)COCC(F)(F)F.
What is the InChIKey of 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol?
The InChIKey is UZLKKCSVDOUVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3O4S/c1-2-17(14,15)5-3-4-8(13)6-16-7-9(10,11)12/h8,13H,2-7H2,1H3.
What are the key properties of 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol?
5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol has a molecular weight of 278.29 g/mol, XLogP of 1.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-ol is sourced from PubChem (CID 103216845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).