About [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine
[5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine (PubChem CID 103217325) has the molecular formula C8H17F3N2O3S
and a molecular weight of 278.30 g/mol. Its IUPAC name is [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine |
| PubChem CID | 103217325 |
| Molecular Formula | C8H17F3N2O3S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(COCC(F)(F)F)NN |
| InChI | InChI=1S/C8H17F3N2O3S/c1-17(14,15)4-2-3-7(13-12)5-16-6-8(9,10)11/h7,13H,2-6,12H2,1H3 |
| InChIKey | AUOHYYWYLLMTKB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine?
The IUPAC name of [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine (CID 103217325) is [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine.
What is the SMILES notation for [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine?
The canonical SMILES for [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine is CS(=O)(=O)CCCC(COCC(F)(F)F)NN.
What is the InChIKey of [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine?
The InChIKey is AUOHYYWYLLMTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3N2O3S/c1-17(14,15)4-2-3-7(13-12)5-16-6-8(9,10)11/h7,13H,2-6,12H2,1H3.
What are the key properties of [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine?
[5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine has a molecular weight of 278.30 g/mol, XLogP of 0.22, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methylsulfonyl-1-(2,2,2-trifluoroethoxy)pentan-2-yl]hydrazine is sourced from PubChem (CID 103217325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).