C10H15N3O2 — CID 103218268
5-amino-2-[(5-methyloxolan-2-yl)methyl]pyridazin-3-one (PubChem CID 103218268) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-amino-2-[(5-methyloxolan-2-yl)methyl]pyridazin-3-one.
| Compound Name | 5-amino-2-[(5-methyloxolan-2-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103218268 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-amino-2-[(5-methyloxolan-2-yl)methyl]pyridazin-3-one |
| SMILES | CC1CCC(Cn2ncc(N)cc2=O)O1 |
| InChI | InChI=1S/C10H15N3O2/c1-7-2-3-9(15-7)6-13-10(14)4-8(11)5-12-13/h4-5,7,9H,2-3,6,11H2,1H3 |
| InChIKey | IYIVGBXPXXIEDI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |