C11H19N3O — CID 103218576
2-(3,3-dimethylbutyl)-5-(methylamino)pyridazin-3-one (PubChem CID 103218576) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-5-(methylamino)pyridazin-3-one.
| Compound Name | 2-(3,3-dimethylbutyl)-5-(methylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103218576 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-5-(methylamino)pyridazin-3-one |
| SMILES | CNc1cnn(CCC(C)(C)C)c(=O)c1 |
| InChI | InChI=1S/C11H19N3O/c1-11(2,3)5-6-14-10(15)7-9(12-4)8-13-14/h7-8,12H,5-6H2,1-4H3 |
| InChIKey | XSSCYCOFXBGLBC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |