C25H18F4O4 — CID 10321897
ethyl 4-(3-benzhydryloxy-3-oxoprop-1-en-2-yl)-2,3,5,6-tetrafluorobenzoate (PubChem CID 10321897) has the molecular formula C25H18F4O4 and a molecular weight of 458.41 g/mol. Its IUPAC name is ethyl 4-(3-benzhydryloxy-3-oxoprop-1-en-2-yl)-2,3,5,6-tetrafluorobenzoate.
| Compound Name | ethyl 4-(3-benzhydryloxy-3-oxoprop-1-en-2-yl)-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 10321897 |
| Molecular Formula | C25H18F4O4 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | ethyl 4-(3-benzhydryloxy-3-oxoprop-1-en-2-yl)-2,3,5,6-tetrafluorobenzoate |
| SMILES | C=C(C(=O)OC(c1ccccc1)c1ccccc1)c1c(F)c(F)c(C(=O)OCC)c(F)c1F |
| InChI | InChI=1S/C25H18F4O4/c1-3-32-25(31)18-21(28)19(26)17(20(27)22(18)29)14(2)24(30)33-23(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,23H,2-3H2,1H3 |
| InChIKey | IJQRDFNPURRTLG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|