C12H11ClINO3S — CID 103219146
3-(3-chloro-4-iodobenzoyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 103219146) has the molecular formula C12H11ClINO3S and a molecular weight of 411.65 g/mol. Its IUPAC name is 3-(3-chloro-4-iodobenzoyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3-chloro-4-iodobenzoyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103219146 |
| Molecular Formula | C12H11ClINO3S |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 3-(3-chloro-4-iodobenzoyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCC(C(=O)O)N1C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClINO3S/c1-6-15(10(5-19-6)12(17)18)11(16)7-2-3-9(14)8(13)4-7/h2-4,6,10H,5H2,1H3,(H,17,18) |
| InChIKey | ILQSSKRRFOOPKL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|