C14H17ClIN5 — CID 103219891
1-[5-(3-chloro-4-iodophenyl)-1H-1,2,4-triazol-3-yl]-2-methylpiperidin-3-amine (PubChem CID 103219891) has the molecular formula C14H17ClIN5 and a molecular weight of 417.68 g/mol. Its IUPAC name is 1-[5-(3-chloro-4-iodophenyl)-1H-1,2,4-triazol-3-yl]-2-methylpiperidin-3-amine.
| Compound Name | 1-[5-(3-chloro-4-iodophenyl)-1H-1,2,4-triazol-3-yl]-2-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 103219891 |
| Molecular Formula | C14H17ClIN5 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 1-[5-(3-chloro-4-iodophenyl)-1H-1,2,4-triazol-3-yl]-2-methylpiperidin-3-amine |
| SMILES | CC1C(N)CCCN1c1n[nH]c(-c2ccc(I)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H17ClIN5/c1-8-12(17)3-2-6-21(8)14-18-13(19-20-14)9-4-5-11(16)10(15)7-9/h4-5,7-8,12H,2-3,6,17H2,1H3,(H,18,19,20) |
| InChIKey | FYINFYVXBAFREL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|