C15H16IN3O — CID 103221865
5-(cyclopropylmethylamino)-2-[(4-iodophenyl)methyl]pyridazin-3-one (PubChem CID 103221865) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is 5-(cyclopropylmethylamino)-2-[(4-iodophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(cyclopropylmethylamino)-2-[(4-iodophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103221865 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 5-(cyclopropylmethylamino)-2-[(4-iodophenyl)methyl]pyridazin-3-one |
| SMILES | O=c1cc(NCC2CC2)cnn1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C15H16IN3O/c16-13-5-3-12(4-6-13)10-19-15(20)7-14(9-18-19)17-8-11-1-2-11/h3-7,9,11,17H,1-2,8,10H2 |
| InChIKey | JAJVJXJRWWYRAL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|