C13H22N4O3 — CID 103222844
5-(2-aminoethoxy)-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one (PubChem CID 103222844) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-(2-aminoethoxy)-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one.
| Compound Name | 5-(2-aminoethoxy)-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103222844 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 5-(2-aminoethoxy)-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one |
| SMILES | CCN1CCOC(Cn2ncc(OCCN)cc2=O)C1 |
| InChI | InChI=1S/C13H22N4O3/c1-2-16-4-6-20-12(9-16)10-17-13(18)7-11(8-15-17)19-5-3-14/h7-8,12H,2-6,9-10,14H2,1H3 |
| InChIKey | BXQUPMUYCFXPDX-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |