About 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one
5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one (PubChem CID 103222940) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one |
| PubChem CID | 103222940 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one |
| SMILES | Cc1cc(C)cc(Cn2ncc(OCC(C)N)cc2=O)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-11-4-12(2)6-14(5-11)9-19-16(20)7-15(8-18-19)21-10-13(3)17/h4-8,13H,9-10,17H2,1-3H3 |
| InChIKey | NMVWNHLVNLJSEZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The IUPAC name of 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one (CID 103222940) is 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one.
What is the SMILES notation for 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The canonical SMILES for 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one is Cc1cc(C)cc(Cn2ncc(OCC(C)N)cc2=O)c1.
What is the InChIKey of 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The InChIKey is NMVWNHLVNLJSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-11-4-12(2)6-14(5-11)9-19-16(20)7-15(8-18-19)21-10-13(3)17/h4-8,13H,9-10,17H2,1-3H3.
What are the key properties of 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one has a molecular weight of 287.36 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminopropoxy)-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one is sourced from PubChem (CID 103222940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).