About 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one
5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one (PubChem CID 103223292) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one |
| PubChem CID | 103223292 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one |
| SMILES | CC1(C)CCC(Cn2ncc(OCCCN)cc2=O)O1 |
| InChI | InChI=1S/C14H23N3O3/c1-14(2)5-4-11(20-14)10-17-13(18)8-12(9-16-17)19-7-3-6-15/h8-9,11H,3-7,10,15H2,1-2H3 |
| InChIKey | HRMSMOAQIVSQPD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one?
The IUPAC name of 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one (CID 103223292) is 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one?
The canonical SMILES for 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one is CC1(C)CCC(Cn2ncc(OCCCN)cc2=O)O1.
What is the InChIKey of 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one?
The InChIKey is HRMSMOAQIVSQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-14(2)5-4-11(20-14)10-17-13(18)8-12(9-16-17)19-7-3-6-15/h8-9,11H,3-7,10,15H2,1-2H3.
What are the key properties of 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one?
5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one has a molecular weight of 281.36 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminopropoxy)-2-[(5,5-dimethyloxolan-2-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 103223292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).