C12H20N4O3 — CID 103223298
3-[4-(3-aminopropoxy)-6-oxopyridazin-1-yl]-N,N-dimethylpropanamide (PubChem CID 103223298) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[4-(3-aminopropoxy)-6-oxopyridazin-1-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-[4-(3-aminopropoxy)-6-oxopyridazin-1-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 103223298 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-[4-(3-aminopropoxy)-6-oxopyridazin-1-yl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCn1ncc(OCCCN)cc1=O |
| InChI | InChI=1S/C12H20N4O3/c1-15(2)11(17)4-6-16-12(18)8-10(9-14-16)19-7-3-5-13/h8-9H,3-7,13H2,1-2H3 |
| InChIKey | IFUPOIBHMVGJMX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|