C13H21N5O3 — CID 103223399
5-[2-aminoethyl(methyl)amino]-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one (PubChem CID 103223399) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-[2-aminoethyl(methyl)amino]-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one.
| Compound Name | 5-[2-aminoethyl(methyl)amino]-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103223399 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 5-[2-aminoethyl(methyl)amino]-2-(2-morpholin-4-yl-2-oxoethyl)pyridazin-3-one |
| SMILES | CN(CCN)c1cnn(CC(=O)N2CCOCC2)c(=O)c1 |
| InChI | InChI=1S/C13H21N5O3/c1-16(3-2-14)11-8-12(19)18(15-9-11)10-13(20)17-4-6-21-7-5-17/h8-9H,2-7,10,14H2,1H3 |
| InChIKey | MWQYATMNZRCOBW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |