C15H20N4O2 — CID 103223467
5-[2-aminoethyl(methyl)amino]-2-(2-phenoxyethyl)pyridazin-3-one (PubChem CID 103223467) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[2-aminoethyl(methyl)amino]-2-(2-phenoxyethyl)pyridazin-3-one.
| Compound Name | 5-[2-aminoethyl(methyl)amino]-2-(2-phenoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103223467 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-[2-aminoethyl(methyl)amino]-2-(2-phenoxyethyl)pyridazin-3-one |
| SMILES | CN(CCN)c1cnn(CCOc2ccccc2)c(=O)c1 |
| InChI | InChI=1S/C15H20N4O2/c1-18(8-7-16)13-11-15(20)19(17-12-13)9-10-21-14-5-3-2-4-6-14/h2-6,11-12H,7-10,16H2,1H3 |
| InChIKey | QFKYAPBHLCZPPT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |