About N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide
N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide (PubChem CID 10322632) has the molecular formula C29H35N3O3
and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide.
Molecular Properties
| Compound Name | N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide |
| PubChem CID | 10322632 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(CNC(=O)Nc2c(C(C)C)cccc2C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N3O3/c1-19(2)24-12-9-13-25(20(3)4)27(24)32-29(34)30-18-26(21-10-7-6-8-11-21)31-28(33)22-14-16-23(35-5)17-15-22/h6-17,19-20,26H,18H2,1-5H3,(H,31,33)(H2,30,32,34) |
| InChIKey | YKTYLLDFBHXSBT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide?
The IUPAC name of N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide (CID 10322632) is N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide.
What is the SMILES notation for N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide?
The canonical SMILES for N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide is COc1ccc(C(=O)NC(CNC(=O)Nc2c(C(C)C)cccc2C(C)C)c2ccccc2)cc1.
What is the InChIKey of N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide?
The InChIKey is YKTYLLDFBHXSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H35N3O3/c1-19(2)24-12-9-13-25(20(3)4)27(24)32-29(34)30-18-26(21-10-7-6-8-11-21)31-28(33)22-14-16-23(35-5)17-15-22/h6-17,19-20,26H,18H2,1-5H3,(H,31,33)(H2,30,32,34).
What are the key properties of N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide?
N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide has a molecular weight of 473.62 g/mol, XLogP of 6.23, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]-1-phenylethyl]-4-methoxybenzamide is sourced from PubChem (CID 10322632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).