C10H20N2O — CID 103227322
2-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxy-N-methylpropan-1-amine (PubChem CID 103227322) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxy-N-methylpropan-1-amine.
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103227322 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxy-N-methylpropan-1-amine |
| SMILES | CNCC(COC)N1CC=CCC1 |
| InChI | InChI=1S/C10H20N2O/c1-11-8-10(9-13-2)12-6-4-3-5-7-12/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | FMVSOLMIHYVZNG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|