About 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine
3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine (PubChem CID 103227561) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine |
| PubChem CID | 103227561 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine |
| SMILES | CNCC(COC)n1nc(C)c(C)c1C |
| InChI | InChI=1S/C11H21N3O/c1-8-9(2)13-14(10(8)3)11(6-12-4)7-15-5/h11-12H,6-7H2,1-5H3 |
| InChIKey | LJJVGSFCXPOSGM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The IUPAC name of 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine (CID 103227561) is 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine.
What is the SMILES notation for 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The canonical SMILES for 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine is CNCC(COC)n1nc(C)c(C)c1C.
What is the InChIKey of 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The InChIKey is LJJVGSFCXPOSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-8-9(2)13-14(10(8)3)11(6-12-4)7-15-5/h11-12H,6-7H2,1-5H3.
What are the key properties of 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine has a molecular weight of 211.31 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-methyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine is sourced from PubChem (CID 103227561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).