C20H21ClN5O5P — CID 10322807
[2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl] dihydrogen phosphate (PubChem CID 10322807) has the molecular formula C20H21ClN5O5P and a molecular weight of 477.85 g/mol. Its IUPAC name is [2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl] dihydrogen phosphate.
| Compound Name | [2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10322807 |
| Molecular Formula | C20H21ClN5O5P |
| Molecular Weight | 477.85 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl] dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)N1CCC(c2[nH]nc(-c3ccc(Cl)cc3)c2-c2ccncn2)CC1 |
| InChI | InChI=1S/C20H21ClN5O5P/c21-15-3-1-13(2-4-15)19-18(16-5-8-22-12-23-16)20(25-24-19)14-6-9-26(10-7-14)17(27)11-31-32(28,29)30/h1-5,8,12,14H,6-7,9-11H2,(H,24,25)(H2,28,29,30) |
| InChIKey | OIDUVLVEWLBCMN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|