C13H18ClNO2 — CID 103228332
N-[2-(3-chlorophenoxy)-3-methoxypropyl]cyclopropanamine (PubChem CID 103228332) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)-3-methoxypropyl]cyclopropanamine.
| Compound Name | N-[2-(3-chlorophenoxy)-3-methoxypropyl]cyclopropanamine |
|---|---|
| PubChem CID | 103228332 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[2-(3-chlorophenoxy)-3-methoxypropyl]cyclopropanamine |
| SMILES | COCC(CNC1CC1)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2/c1-16-9-13(8-15-11-5-6-11)17-12-4-2-3-10(14)7-12/h2-4,7,11,13,15H,5-6,8-9H2,1H3 |
| InChIKey | LAFSHTULBXCHLY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |