C29H34O4S — CID 10322846
(4E,6E,10Z)-1-(1-benzothiophen-2-yl)-4-methyl-11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trien-1-ol (PubChem CID 10322846) has the molecular formula C29H34O4S and a molecular weight of 478.65 g/mol. Its IUPAC name is (4E,6E,10Z)-1-(1-benzothiophen-2-yl)-4-methyl-11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trien-1-ol.
| Compound Name | (4E,6E,10Z)-1-(1-benzothiophen-2-yl)-4-methyl-11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trien-1-ol |
|---|---|
| PubChem CID | 10322846 |
| Molecular Formula | C29H34O4S |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (4E,6E,10Z)-1-(1-benzothiophen-2-yl)-4-methyl-11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trien-1-ol |
| SMILES | COc1cc(/C=C\CC/C=C/C=C(\C)CCC(O)c2cc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34O4S/c1-21(16-17-24(30)28-20-23-14-10-11-15-27(23)34-28)12-8-6-5-7-9-13-22-18-25(31-2)29(33-4)26(19-22)32-3/h6,8-15,18-20,24,30H,5,7,16-17H2,1-4H3/b8-6+,13-9-,21-12+ |
| InChIKey | UEWWIEPCQQKLQM-XYOINWQISA-N |
| XLogP | 7.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|