C28H22N2O4S — CID 10322984
4-methylbenzenesulfonate;2-(1-methylpyridin-1-ium-4-yl)phenanthro[9,10-d][1,3]oxazole (PubChem CID 10322984) has the molecular formula C28H22N2O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;2-(1-methylpyridin-1-ium-4-yl)phenanthro[9,10-d][1,3]oxazole.
| Compound Name | 4-methylbenzenesulfonate;2-(1-methylpyridin-1-ium-4-yl)phenanthro[9,10-d][1,3]oxazole |
|---|---|
| PubChem CID | 10322984 |
| Molecular Formula | C28H22N2O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-methylbenzenesulfonate;2-(1-methylpyridin-1-ium-4-yl)phenanthro[9,10-d][1,3]oxazole |
| SMILES | C[n+]1ccc(-c2nc3c4ccccc4c4ccccc4c3o2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H15N2O.C7H8O3S/c1-23-12-10-14(11-13-23)21-22-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)20(19)24-21;1-6-2-4-7(5-3-6)11(8,9)10/h2-13H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | HDQHJPOOPJSDHC-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 87.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|