2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid

C9H17NO2 — CID 103230430

IUPAC2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid
SMILESC=C(CNC(C)C(C)C)C(=O)O
InChIInChI=1S/C9H17NO2/c1-6(2)8(4)10-5-7(3)9(11)12/h6,8,10H,3,5H2,1-2,4H3,(H,11,12)
InChIKeyMVUTWNAGYDWQEZ-UHFFFAOYSA-N
MW171.24 g/mol
LogP1.26
Rot. Bonds5

About 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid

2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid (PubChem CID 103230430) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid.

Molecular Properties

Compound Name2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid
PubChem CID103230430
Molecular FormulaC9H17NO2
Molecular Weight171.24 g/mol
Exact Mass171.13
IUPAC Name2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid
SMILESC=C(CNC(C)C(C)C)C(=O)O
InChIInChI=1S/C9H17NO2/c1-6(2)8(4)10-5-7(3)9(11)12/h6,8,10H,3,5H2,1-2,4H3,(H,11,12)
InChIKeyMVUTWNAGYDWQEZ-UHFFFAOYSA-N
XLogP1.26
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.24
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(1-Fluorobutylamino)-2-methylidenebutanoic acid
CID 87752724
2-[(4,4,4-Trifluorobutan-2-ylamino)methyl]prop-2-enoic acid
CID 105942321
2-(Ethylaminomethyl)prop-2-enoic acid
CID 17787601
2-(Methylaminomethyl)prop-2-enoic acid
CID 20146063
3-(Tert-butylamino)-2-methylidenebutanoic acid
CID 22389688
2-[(Propan-2-ylamino)methyl]prop-2-enoic acid
CID 23286806
2-Methyl-3-(2-methylprop-2-enoylamino)butanoic acid
CID 54456314
2-[(Tert-butylamino)methyl]prop-2-enoic acid
CID 56979824
2-Methylidene-3-(prop-2-enylamino)butanoic acid
CID 87250383
3-(Butylamino)-2-methylidenebutanoic acid
CID 87330560
2-(Butylaminomethyl)prop-2-enoic acid
CID 87476634
2-[(Pentylamino)methyl]prop-2-enoic acid
CID 87503709

Frequently Asked Questions

What is the IUPAC name of 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid?
The IUPAC name of 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid (CID 103230430) is 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid.
What is the SMILES notation for 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid?
The canonical SMILES for 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid is C=C(CNC(C)C(C)C)C(=O)O.
What is the InChIKey of 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid?
The InChIKey is MVUTWNAGYDWQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-6(2)8(4)10-5-7(3)9(11)12/h6,8,10H,3,5H2,1-2,4H3,(H,11,12).
What are the key properties of 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid?
2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid has a molecular weight of 171.24 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methylbutan-2-ylamino)methyl]prop-2-enoic acid is sourced from PubChem (CID 103230430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).