C11H18N2O5 — CID 103231226
1-[2-[(2-methoxy-2-oxoethyl)amino]acetyl]piperidine-4-carboxylic acid (PubChem CID 103231226) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[2-[(2-methoxy-2-oxoethyl)amino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(2-methoxy-2-oxoethyl)amino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103231226 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-[(2-methoxy-2-oxoethyl)amino]acetyl]piperidine-4-carboxylic acid |
| SMILES | COC(=O)CNCC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H18N2O5/c1-18-10(15)7-12-6-9(14)13-4-2-8(3-5-13)11(16)17/h8,12H,2-7H2,1H3,(H,16,17) |
| InChIKey | VQMUYQJBSIBKSA-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |