C16H13NO3 — CID 103231526
3-[(naphthalen-1-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 103231526) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-[(naphthalen-1-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(naphthalen-1-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103231526 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-[(naphthalen-1-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CNc1cccc2ccccc12 |
| InChI | InChI=1S/C16H13NO3/c18-16(19)15-12(8-9-20-15)10-17-14-7-3-5-11-4-1-2-6-13(11)14/h1-9,17H,10H2,(H,18,19) |
| InChIKey | OCAVIMKMDOFVDL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |