C30H33NO5 — CID 10323185
N-[(1S,2R,3S,4S,5R)-2-hydroxy-6-methylidene-3,4,5-tris(phenylmethoxy)cyclohexyl]acetamide (PubChem CID 10323185) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[(1S,2R,3S,4S,5R)-2-hydroxy-6-methylidene-3,4,5-tris(phenylmethoxy)cyclohexyl]acetamide.
| Compound Name | N-[(1S,2R,3S,4S,5R)-2-hydroxy-6-methylidene-3,4,5-tris(phenylmethoxy)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 10323185 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[(1S,2R,3S,4S,5R)-2-hydroxy-6-methylidene-3,4,5-tris(phenylmethoxy)cyclohexyl]acetamide |
| SMILES | C=C1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C30H33NO5/c1-21-26(31-22(2)32)27(33)29(35-19-24-14-8-4-9-15-24)30(36-20-25-16-10-5-11-17-25)28(21)34-18-23-12-6-3-7-13-23/h3-17,26-30,33H,1,18-20H2,2H3,(H,31,32)/t26-,27+,28+,29-,30-/m0/s1 |
| InChIKey | MTTJQDQMYNXENC-CDTAUBPISA-N |
| XLogP | 4.18 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|